Introduction：Basic information about CAS 18381-53-8|ethyl hexafluoroglutaryl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl hexafluoroglutaryl chloride |
|---|
| CAS Number | 18381-53-8 | Molecular Weight | 286.55600 |
|---|
| Density | 1.47 | Boiling Point | 159ºC |
|---|
| Molecular Formula | C7H5ClF6O3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 158-160ºC |
|---|
Names
| Name | ethyl 5-chloro-2,2,3,3,4,4-hexafluoro-5-oxopentanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.47 |
|---|
| Boiling Point | 159ºC |
|---|
| Molecular Formula | C7H5ClF6O3 |
|---|
| Molecular Weight | 286.55600 |
|---|
| Flash Point | 158-160ºC |
|---|
| Exact Mass | 285.98300 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.22080 |
|---|
| Index of Refraction | 1.359 |
|---|
| InChIKey | OLRXGDHRDQKNGW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)Cl |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3265 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-Carbethoxyhexafluorobutyryl chloride |
| MFCD00054671 |
| 4CE-Hfba |
| Ethyl Hexafluoroglutaryl Chloride |
