Introduction：Basic information about CAS 330562-44-2|1H,1H,11H,11H-PERFLUORO-3,6,9-TRIOXAUNDECANE-1,11-DIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H,1H,11H,11H-PERFLUORO-3,6,9-TRIOXAUNDECANE-1,11-DIOL |
|---|
| CAS Number | 330562-44-2 | Molecular Weight | 410.11100 |
|---|
| Density | 1.706g/cm3 | Boiling Point | 88ºC 0,2mm |
|---|
| Molecular Formula | C8H6F12O5 | Melting Point | 40-42ºC |
|---|
| MSDS | / | Flash Point | 160ºC |
|---|
Names
| Name | 1H,1H,11H,11H-Perfluoro-3,6,9-trioxaundecane-1,11-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.706g/cm3 |
|---|
| Boiling Point | 88ºC 0,2mm |
|---|
| Melting Point | 40-42ºC |
|---|
| Molecular Formula | C8H6F12O5 |
|---|
| Molecular Weight | 410.11100 |
|---|
| Flash Point | 160ºC |
|---|
| Exact Mass | 410.00200 |
|---|
| PSA | 68.15000 |
|---|
| LogP | 2.57760 |
|---|
| Index of Refraction | 1.331 |
|---|
| InChIKey | BFMDZOWJRVLYPB-UHFFFAOYSA-N |
|---|
| SMILES | OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)CO |
|---|
Safety Information
Synonyms
| 2-[2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol |
| MFCD04038352 |
