Introduction：Basic information about CAS 29051-44-3|6-Phenylnicotinic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Phenylnicotinic acid |
|---|
| CAS Number | 29051-44-3 | Molecular Weight | 199.205 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 388.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9NO2 | Melting Point | 243ºC |
|---|
| MSDS | / | Flash Point | 188.5±24.6 °C |
|---|
Names
| Name | 6-phenylpyridine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 388.1±30.0 °C at 760 mmHg |
|---|
| Melting Point | 243ºC |
|---|
| Molecular Formula | C12H9NO2 |
|---|
| Molecular Weight | 199.205 |
|---|
| Flash Point | 188.5±24.6 °C |
|---|
| Exact Mass | 199.063324 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 2.15 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | DLFLQXUYRFIFOK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(-c2ccccc2)nc1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Pyridinecarboxylic acid, 6-phenyl- |
| 6-phenylpyridine-3-carboxylic acid |
| 6-Phenyl-nicotinic acid |
| 3-Carboxy-6-phenylpyridine |
| 6-phenyl-3-pyridinecarboxylic acid |
| 6-Phenylnicotinic acid |
| 2-phenyl-5-carboxypyridine |
| 6-Phenyl-nicotinsaeure |
| 2-phenyl-5-pyridinecarboxylic acid |
