Introduction：Basic information about CAS 6410-29-3|4-[[5-(anilino)carbonyl-2-methoxyphenyl]azo]-3-hydroxy-N-phenylnaphthalene-2-carboxami, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[[5-(anilino)carbonyl-2-methoxyphenyl]azo]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|
| CAS Number | 6410-29-3 | Molecular Weight | 516.54700 |
|---|
| Density | 1.27 | Boiling Point | / |
|---|
| Molecular Formula | C31H24N4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-3-oxo-N-phenylnaphthalene-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.27 |
|---|
| Molecular Formula | C31H24N4O4 |
|---|
| Molecular Weight | 516.54700 |
|---|
| Exact Mass | 516.18000 |
|---|
| PSA | 112.38000 |
|---|
| LogP | 7.62000 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | JBJBSAHNMRBDSH-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1N=Nc1c(O)c(C(=O)Nc2ccccc2)cc2ccccc12 |
|---|
Synonyms
| 2-Naphthalenecarboxamide,3-hydroxy-4-(2-(2-methoxy-5-((phenylamino)carbonyl)phenyl)diazenyl)-N-phenyl |
| 2-Naphthalenecarboxamide,3-hydroxy-4-((2-methoxy-5-((phenylamino)carbonyl)phenyl)azo)-N-phenyl |
| V0985 |
| EINECS 229-099-0 |
| 4-((5-(Anilino)carbonyl-2-methoxyphenyl)azo)-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| Pigment Red 32 |
