Introduction:Basic information about CAS 921939-00-6|2-[4-(chloromethyl)phenoxy]-6-methylpyrazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-(chloromethyl)phenoxy]-6-methylpyrazine |
|---|
| CAS Number | 921939-00-6 | Molecular Weight | 234.68200 |
|---|
| Density | 1.232g/cm3 | Boiling Point | 351.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11ClN2O | Melting Point | 41.5-44ºC |
|---|
| MSDS | / | Flash Point | 166.6ºC |
|---|
Names
| Name | 2-[4-(chloromethyl)phenoxy]-6-methylpyrazine |
|---|
Chemical & Physical Properties
| Density | 1.232g/cm3 |
|---|
| Boiling Point | 351.8ºC at 760 mmHg |
|---|
| Melting Point | 41.5-44ºC |
|---|
| Molecular Formula | C12H11ClN2O |
|---|
| Molecular Weight | 234.68200 |
|---|
| Flash Point | 166.6ºC |
|---|
| Exact Mass | 234.05600 |
|---|
| PSA | 35.01000 |
|---|
| LogP | 3.31610 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | SIBSXPKNEXNSKN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cncc(Oc2ccc(CCl)cc2)n1 |
|---|