Introduction：Basic information about CAS 334757-72-1|2-beta-Carboxyethylamino-4-aminobenzenesulfonicacid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-beta-Carboxyethylamino-4-aminobenzenesulfonicacid |
|---|
| CAS Number | 334757-72-1 | Molecular Weight | 260.26700 |
|---|
| Density | 1.61 | Boiling Point | / |
|---|
| Molecular Formula | C9H12N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-β-Carboxyethylamino-4-aminobenzenesulfonicacid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.61 |
|---|
| Molecular Formula | C9H12N2O5S |
|---|
| Molecular Weight | 260.26700 |
|---|
| Exact Mass | 260.04700 |
|---|
| PSA | 138.10000 |
|---|
| LogP | 2.13710 |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | YLVKVGAKZMEMIU-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(S(=O)(=O)O)c(NCCC(=O)O)c1 |
|---|
Synonyms
| 5-amino-2-sulphonic-N-ethylacetatic-aniline |
| 4-amino-2-(2-carboxyethyl)amino benzene sulfonic acid |
| 4-Amino-2-(Carboxyethyl)Amino Benzene Sulfonic Acid |
