Introduction:Basic information about CAS 474-98-6|Bicyclo[2.2.1]heptane-2-carboxylicacid, 4,7,7-trimethyl-3-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bicyclo[2.2.1]heptane-2-carboxylicacid, 4,7,7-trimethyl-3-oxo- |
|---|
| CAS Number | 474-98-6 | Molecular Weight | 196.24300 |
|---|
| Density | 1.174g/cm3 | Boiling Point | 317.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.1ºC |
|---|
Names
| Name | 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.174g/cm3 |
|---|
| Boiling Point | 317.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H16O3 |
|---|
| Molecular Weight | 196.24300 |
|---|
| Flash Point | 160.1ºC |
|---|
| Exact Mass | 196.11000 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 1.71240 |
|---|
| Vapour Pressure | 8.03E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.516 |
|---|
| InChIKey | XNMVAVGXJZFTEH-UHFFFAOYSA-N |
|---|
| SMILES | CC12CCC(C(C(=O)O)C1=O)C2(C)C |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Opt.-inakt. 4,7,7-Trimethyl-3-oxo-norbornan-2-carbonsaeure |
| (+/-)-camphor-3-carboxylic acid |
| 2-oxobornane-3-carboxylic acid |
| 4,7,7-Trimethyl-3-oxo-norbornan-2-carbonsaeure |
| optically inactive 4,7,7-trimethyl-3-oxo-norbornane-2-carboxylic acid |
| 1,7,7-Trimethyl-bicyclo<2.2.1>heptanon-(2)-carbonsaeure-(3) |
| D,L-3-Camphorcarboxylic acid |
| Camphocarboxylic acid |