Introduction：Basic information about CAS 82-27-9|9,10-Anthracenedione,2-amino-1-chloro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-Anthracenedione,2-amino-1-chloro- |
|---|
| CAS Number | 82-27-9 | Molecular Weight | 257.67200 |
|---|
| Density | 1.486g/cm3 | Boiling Point | 500.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.7ºC |
|---|
Names
| Name | 2-amino-1-chloroanthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.486g/cm3 |
|---|
| Boiling Point | 500.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8ClNO2 |
|---|
| Molecular Weight | 257.67200 |
|---|
| Flash Point | 256.7ºC |
|---|
| Exact Mass | 257.02400 |
|---|
| PSA | 60.16000 |
|---|
| LogP | 3.27880 |
|---|
| Index of Refraction | 1.711 |
|---|
| InChIKey | PLGPRGMWHYWEFT-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
|---|
Safety Information
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Amino-1-chlor-anthrachinon |
| 1-Chloro-2-aminoanthraquinone |
| 9,2-amino-1-chloro |
| 2-Amino-1-chloroanthraquinone |
| 2-amino-1-chloro-9,10-anthracenedione |
| 1-Chlor-2-amino-anthrachinon |
| 1-Chloro-2-anthraquinonylamine |
