Introduction：Basic information about CAS 6332-05-4|1,3,5,7-tetramethylanthracene-9,10-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5,7-tetramethylanthracene-9,10-dione |
|---|
| CAS Number | 6332-05-4 | Molecular Weight | 264.31800 |
|---|
| Density | 1.179g/cm3 | Boiling Point | 448.2ºC at 760 mmHg |
|---|
| Molecular Formula | C18H16O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167ºC |
|---|
Names
| Name | 1,3,5,7-tetramethylanthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.179g/cm3 |
|---|
| Boiling Point | 448.2ºC at 760 mmHg |
|---|
| Molecular Formula | C18H16O2 |
|---|
| Molecular Weight | 264.31800 |
|---|
| Flash Point | 167ºC |
|---|
| Exact Mass | 264.11500 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.69560 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | ISQFYHBWKRJRKI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c2c(c1)C(=O)c1c(C)cc(C)cc1C2=O |
|---|
Synonyms
| 9.10-Dioxo-1.3.5.7-tetramethyl-9.10-dihydro-anthracen |
| 1,3,5,7-Tetramethyl-anthrachinon |
| 1,3,5,7-tetramethyl-anthraquinone |
