Introduction：Basic information about CAS 6337-34-4|2,2-dimethyl-5-phenyl-1,3-dioxolan-4-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-dimethyl-5-phenyl-1,3-dioxolan-4-one |
|---|
| CAS Number | 6337-34-4 | Molecular Weight | 192.21100 |
|---|
| Density | 1.131g/cm3 | Boiling Point | 302.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.3ºC |
|---|
Names
| Name | 2,2-dimethyl-5-phenyl-1,3-dioxolan-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.131g/cm3 |
|---|
| Boiling Point | 302.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O3 |
|---|
| Molecular Weight | 192.21100 |
|---|
| Flash Point | 123.3ºC |
|---|
| Exact Mass | 192.07900 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 2.03720 |
|---|
| Index of Refraction | 1.511 |
|---|
| InChIKey | JKKLKPFEVGIRGI-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OC(=O)C(c2ccccc2)O1 |
|---|
Synonyms
| 1,3-dioxolan-2,2'-dimethyl-5-phenyl-4-one |
| (+-)-2,2-Dimethyl-5-phenyl-[1,3]dioxolan-4-on |
| 2,2-dimethyl-5-(2-tetrahydropyrrolylidene)-1,3-dioxane-4,6-dione |
| 2,2-dimethyl-5-pyrrolidin-2-ylidene-[1,3]dioxane-4.6-dione |
| (+-)-2,2-dimethyl-5-phenyl-[1,3]dioxolan-4-one |
| 2,2-dimethyl-5-(RS)-phenyl-1,3-dioxolan-4-one |
