Introduction:Basic information about CAS 6301-18-4|Carbamic acid,N-[1,1'-biphenyl]-2-yl-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carbamic acid,N-[1,1'-biphenyl]-2-yl-, ethyl ester |
|---|
| CAS Number | 6301-18-4 | Molecular Weight | 241.28500 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 340.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160ºC |
|---|
Names
| Name | ethyl N-(2-phenylphenyl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 340.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO2 |
|---|
| Molecular Weight | 241.28500 |
|---|
| Flash Point | 160ºC |
|---|
| Exact Mass | 241.11000 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 3.99500 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | SMZPSCLWIVWFLG-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Nc1ccccc1-c1ccccc1 |
|---|
Synonyms
| biphenyl-2-yl-carbamic acid ethyl ester |
| o-Diphenylyl-carbamidsaeure-aethylester |
| Biphenyl-2-yl-carbamidsaeure-aethylester |
| o-Xenyl-urethan |
| 2-ethoxycarbonylaminobiphenyl |
| ethyl 2-biphenylylcarbamate |
| 2-Aethoxycarbonylaminobiphenyl |