Introduction：Basic information about CAS 66842-80-6|1H-Pyrido[4,3-b]indol-4-ol, 2,3,4,5-tetrahydro-2-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrido[4,3-b]indol-4-ol, 2,3,4,5-tetrahydro-2-methyl- |
|---|
| CAS Number | 66842-80-6 | Molecular Weight | 202.25200 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 212.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 82.3ºC |
|---|
Names
| Name | 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-4-ol |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 212.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O |
|---|
| Molecular Weight | 202.25200 |
|---|
| Flash Point | 82.3ºC |
|---|
| Exact Mass | 202.11100 |
|---|
| PSA | 39.26000 |
|---|
| LogP | 1.58460 |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | VWCAYXIOLFWPNK-UHFFFAOYSA-N |
|---|
| SMILES | CN1Cc2c([nH]c3ccccc23)C(O)C1 |
|---|
