Introduction：Basic information about CAS 56437-96-8|3-chloro-N-(phenylthiocarbamoyl)benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-chloro-N-(phenylthiocarbamoyl)benzamide |
|---|
| CAS Number | 56437-96-8 | Molecular Weight | 290.76800 |
|---|
| Density | 1.38g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H11ClN2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-chloro-N-(phenylcarbamothioyl)benzamide |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Molecular Formula | C14H11ClN2OS |
|---|
| Molecular Weight | 290.76800 |
|---|
| Exact Mass | 290.02800 |
|---|
| PSA | 73.22000 |
|---|
| LogP | 3.93070 |
|---|
| Index of Refraction | 1.698 |
|---|
| InChIKey | SJXMOLZQFGGHPD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NC(=S)Nc1ccccc1)c1cccc(Cl)c1 |
|---|
