Introduction：Basic information about CAS 29366-72-1|1,3,5-Triazine-2,4-diamine,6-(3-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-Triazine-2,4-diamine,6-(3-nitrophenyl)- |
|---|
| CAS Number | 29366-72-1 | Molecular Weight | 232.19900 |
|---|
| Density | 1.539g/cm3 | Boiling Point | 578.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H8N6O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 303.5ºC |
|---|
Names
| Name | 6-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.539g/cm3 |
|---|
| Boiling Point | 578.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H8N6O2 |
|---|
| Molecular Weight | 232.19900 |
|---|
| Flash Point | 303.5ºC |
|---|
| Exact Mass | 232.07100 |
|---|
| PSA | 136.53000 |
|---|
| LogP | 2.29680 |
|---|
| Vapour Pressure | 2.3E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.729 |
|---|
| InChIKey | VPHQFMMMDMEBFG-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(N)nc(-c2cccc([N+](=O)[O-])c2)n1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 6-(3-nitro-phenyl)-[1,3,5]triazine-2,4-diamine |
| 2,4-diamino-6-(3-nitrophenyl)-1,3,5-triazine |
| 2-<3-Nitrophenyl>-4,6-diamino-1.3.5-triazin |
| 6-(3-Nitro-phenyl)-[1,3,5]triazin-2,4-diyldiamin |
| 6-(3-nitro-phenyl)-[1,3,5]triazine-2,4-diyldiamine |
| 1,3,5-Triazine-2,4-diamine,6-(3-nitrophenyl) |
| 2-m-Nitrophenyl-4,6-diamino-s-triazin |
| 2,4-Diamino-6-(m-nitrophenyl)-s-triazin |
