Introduction：Basic information about CAS 5855-78-7|Benzoic acid,5-amino-2-chloro-4-sulfo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,5-amino-2-chloro-4-sulfo- |
|---|
| CAS Number | 5855-78-7 | Molecular Weight | 251.64400 |
|---|
| Density | 1.81g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H6ClNO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-amino-2-chloro-4-sulfobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.81g/cm3 |
|---|
| Molecular Formula | C7H6ClNO5S |
|---|
| Molecular Weight | 251.64400 |
|---|
| Exact Mass | 250.96600 |
|---|
| PSA | 126.07000 |
|---|
| LogP | 2.52910 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | JGSAMPZLJLDOKW-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(C(=O)O)c(Cl)cc1S(=O)(=O)O |
|---|
Synonyms
| Benzoic acid,5-amino-2-chloro-4-sulfo |
| EINECS 227-468-0 |
| 3-amino-6-chloro-4-sulfobenzoic acid |
| 5-Amino-2-chloro-4-sulphobenzoic acid |
