Introduction：Basic information about CAS 58562-33-7|4-Hydroxyestrone-4-methyl ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Hydroxyestrone-4-methyl ether |
|---|
| CAS Number | 58562-33-7 | Molecular Weight | 300.39 |
|---|
| Density | 1.172g/cm3 | Boiling Point | 471.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.2ºC |
|---|
Names
| Name | (8R,9S,13S,14S)-3-hydroxy-4-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.172g/cm3 |
|---|
| Boiling Point | 471.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24O3 |
|---|
| Molecular Weight | 300.39 |
|---|
| Flash Point | 169.2ºC |
|---|
| Exact Mass | 304.19500 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.82600 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | PUEXVLNGOBYUEW-BFDPJXHCSA-N |
|---|
| SMILES | COc1c(O)ccc2c1CCC1C2CCC2(C)C(=O)CCC12 |
|---|
Synonyms
| 4-Methoxyestrone |
| 4-Hydroxyestrone-4-methyl ether |
| 4-methoxy-E1 |
