Introduction:Basic information about CAS 58645-50-4|(E)-1-METHOXY-2-(2-NITROPROP-1-EN-1-YL)BENZENE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-1-METHOXY-2-(2-NITROPROP-1-EN-1-YL)BENZENE |
|---|
| CAS Number | 58645-50-4 | Molecular Weight | 193.19900 |
|---|
| Density | 1.157g/cm3 | Boiling Point | 306.136ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.865ºC |
|---|
Names
| Name | 1-(2-methoxyphenyl)-2-nitropropene |
|---|
Chemical & Physical Properties
| Density | 1.157g/cm3 |
|---|
| Boiling Point | 306.136ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO3 |
|---|
| Molecular Weight | 193.19900 |
|---|
| Flash Point | 136.865ºC |
|---|
| Exact Mass | 193.07400 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.85590 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | OFYVONMDKJKATB-BQYQJAHWSA-N |
|---|
| SMILES | COc1ccccc1C=C(C)[N+](=O)[O-] |
|---|