Introduction:Basic information about CAS 7779-31-9|(3,3,5-trimethylcyclohexyl) 2-methylprop-2-enoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3,3,5-trimethylcyclohexyl) 2-methylprop-2-enoate |
|---|
| CAS Number | 7779-31-9 | Molecular Weight | 210.31300 |
|---|
| Density | 0.93 | Boiling Point | 79ºC1 mm Hg(lit.) |
|---|
| Molecular Formula | C13H22O2 | Melting Point | -15ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 208 °F |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | (3,3,5-trimethylcyclohexyl) 2-methylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.93 |
|---|
| Boiling Point | 79ºC1 mm Hg(lit.) |
|---|
| Melting Point | -15ºC(lit.) |
|---|
| Molecular Formula | C13H22O2 |
|---|
| Molecular Weight | 210.31300 |
|---|
| Flash Point | 208 °F |
|---|
| Exact Mass | 210.16200 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.32050 |
|---|
| Index of Refraction | n20/D 1.456(lit.) |
|---|
| InChIKey | DABQKEQFLJIRHU-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)OC1CC(C)CC(C)(C)C1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S28 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| (3.3.5-Trimethyl-cyclohexyl)-methacrylat |
| 3,3,5-trimethylcyclohexyl 2-methylprop-2-enoate |
| methacrylic acid-(3,3,5-trimethyl-cyclohexyl ester) |
| Methacrylsaeure-(3,3,5-trimethyl-cyclohexylester) |
| EINECS 231-927-0 |
| 3,3,5-Trimethylcyclohexyl methacrylate,mixture of isomers |
| Opt.-inakt. 5-Methacryloyloxy-1.1.3-trimethyl-cyclohexan |
| 3,3,5-trimethylcyclohexyl (meth)acrylate |
| MFCD00078372 |