Introduction：Basic information about CAS 77794-93-5|benzyltriethylammonium tetrafluoroborate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | benzyltriethylammonium tetrafluoroborate |
|---|
| CAS Number | 77794-93-5 | Molecular Weight | 279.12500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H22BF4N | Melting Point | 110-112ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | benzyl(triethyl)azanium,tetrafluoroborate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 110-112ºC |
|---|
| Molecular Formula | C13H22BF4N |
|---|
| Molecular Weight | 279.12500 |
|---|
| Exact Mass | 279.17800 |
|---|
| PSA | 3.24000 |
|---|
| LogP | 4.38400 |
|---|
| InChIKey | KJWXXJMAQURGGG-UHFFFAOYSA-N |
|---|
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.F[B-](F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2923900090 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| N-benzyl-N,N,N-triethylammoniumtetrafluoroborate |
| MFCD00011823 |
| benzyl(triethyl)azanium tetrafluoroborate |
| PC0721 |
| benzyltriethylammonium tetrafluoroborate |
| triethylbenzylammonium tetrafluoroborate |
| EINECS 278-768-3 |
