Introduction：Basic information about CAS 792-39-2|bis(a,2-dichloro-benzal)hydrazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(a,2-dichloro-benzal)hydrazine |
|---|
| CAS Number | 792-39-2 | Molecular Weight | 346.03900 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 448.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H8Cl4N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.3ºC |
|---|
Names
| Name | bis(a,2-dichloro-benzal)hydrazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 448.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H8Cl4N2 |
|---|
| Molecular Weight | 346.03900 |
|---|
| Flash Point | 225.3ºC |
|---|
| Exact Mass | 343.94400 |
|---|
| PSA | 24.72000 |
|---|
| LogP | 5.57940 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | STSYYFNBAHTXBF-AXPXABNXSA-N |
|---|
| SMILES | ClC(=NN=C(Cl)c1ccccc1Cl)c1ccccc1Cl |
|---|
Synonyms
| N,N'-di (2,6-dimethylphenyl) urea |
| 2,2',6,6'-Tetramethyl-diphenylcarbamid |
| Urea,N,N'-bis(2,6-dimethylphenyl) |
| N,N'-Bis-<2,6-dimethyl-phenyl>-harnstoff |
| N,N'-bis-(2,6-dimethyl-phenyl)-urea |
