Introduction:Basic information about CAS 81024-43-3|(R)-Metoprolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-Metoprolol |
|---|
| CAS Number | 81024-43-3 | Molecular Weight | 267.364 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 398.6±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H25NO3 | Melting Point | 39-42ºC |
|---|
| MSDS | / | Flash Point | 194.9±26.5 °C |
|---|
Names
| Name | (2R)-1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 398.6±37.0 °C at 760 mmHg |
|---|
| Melting Point | 39-42ºC |
|---|
| Molecular Formula | C15H25NO3 |
|---|
| Molecular Weight | 267.364 |
|---|
| Flash Point | 194.9±26.5 °C |
|---|
| Exact Mass | 267.183441 |
|---|
| PSA | 50.72000 |
|---|
| LogP | 1.79 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | IUBSYMUCCVWXPE-CQSZACIVSA-N |
|---|
| SMILES | COCCc1ccc(OCC(O)CNC(C)C)cc1 |
|---|
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
|---|
Synonyms
| 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (2R)- |
| BIDD:GT0581 |
| 2-Propanol, 1-(4-(2-methoxyethyl)phenoxy)-3-((1-methylethyl)amino)-, (2R)- |
| (2R)-metoprolol |
| (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol |
| (+)-Metoprolol |
| d-Metoprolol |
| (R)-metoprolol |
| (R)-1-isopropylamino-3-[4-(2-metoxyethyl)phenoxy]propan-2-ol |