Introduction：Basic information about CAS 18591-57-6|5,6-DIPHENYLPYRAZIN-2-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-DIPHENYLPYRAZIN-2-OL |
|---|
| CAS Number | 18591-57-6 | Molecular Weight | 248.27900 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 492.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 251.4ºC |
|---|
Names
| Name | 5,6-diphenyl-1H-pyrazin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 492.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12N2O |
|---|
| Molecular Weight | 248.27900 |
|---|
| Flash Point | 251.4ºC |
|---|
| Exact Mass | 248.09500 |
|---|
| PSA | 45.75000 |
|---|
| LogP | 3.10390 |
|---|
| Vapour Pressure | 2.61E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | LTWBZUZTTUVPIM-UHFFFAOYSA-N |
|---|
| SMILES | O=c1cnc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
|---|
Synonyms
| 5,6-diphenylpyrazin-2-(1H)-one |
| 1.2-Dihydro-2-oxo-3.5-diphenylpyrazin |
| 5,6-diphenylpyrazin-2-ol |
| 5,6-diphenyl-2(1H)-pyrazinone |
| 5,6-Diphenyl-2-pyrazinol |
| 5,6-Diphenyl-1H-pyrazin-2-on |
| 5.6-Diphenyl-pyrazin-2-on |
| 2,3-Diphenyl-6-hydroxypyrazine |
