Introduction:Basic information about CAS 4544-43-8|Ethyl 2-bromo-4,4,4-trifluoro-3-oxobutanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 2-bromo-4,4,4-trifluoro-3-oxobutanoate |
|---|
| CAS Number | 4544-43-8 | Molecular Weight | 263.00900 |
|---|
| Density | 1.663 | Boiling Point | 199ºC |
|---|
| Molecular Formula | C6H6BrF3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 74ºC |
|---|
Names
| Name | Ethyl 2-bromo-4,4,4-trifluoro-3-oxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.663 |
|---|
| Boiling Point | 199ºC |
|---|
| Molecular Formula | C6H6BrF3O3 |
|---|
| Molecular Weight | 263.00900 |
|---|
| Flash Point | 74ºC |
|---|
| Exact Mass | 261.94500 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.44440 |
|---|
| InChIKey | ZJTZICBXLSNOHU-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(Br)C(=O)C(F)(F)F |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2-Brom-2-<trifluor-acetyl>-essigsaeure-aethylester |
| Ethyl pound inverted question mark2-Bromo-4,4,4-trifluoro-3-oxobutanoate |
| PC5768 |
| 2-bromo-4,4,4-trifluoro-3-oxo-butyric acid ethyl ester |
| ethyl-2-bromo-4,4,4-trifluoro-3-oxobutanoate |
| Ethyl trifluoroacetylbromoacetate |
| 2-bromo-4,4,4-trifluoro-3-oxo-butanoic acid,ethyl ester |