Introduction：Basic information about CAS 188259-69-0|4-Hydroxy Valsartan, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Hydroxy Valsartan |
|---|
| CAS Number | 188259-69-0 | Molecular Weight | 451.518 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 733.7±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H29N5O4 | Melting Point | 130-132ºC |
|---|
| MSDS | / | Flash Point | 397.6±35.7 °C |
|---|
Names
| Name | 4-Hydroxy Valsartan |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 733.7±70.0 °C at 760 mmHg |
|---|
| Melting Point | 130-132ºC |
|---|
| Molecular Formula | C24H29N5O4 |
|---|
| Molecular Weight | 451.518 |
|---|
| Flash Point | 397.6±35.7 °C |
|---|
| Exact Mass | 451.221954 |
|---|
| PSA | 132.30000 |
|---|
| LogP | 3.09 |
|---|
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | ICSQZMPILLPFKC-XLDIYJRPSA-N |
|---|
| SMILES | CC(O)CCC(=O)N(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(C(=O)O)C(C)C |
|---|
Synonyms
| N-(4-Hydroxypentanoyl)-N-{[2'-(2H-tetrazol-5-yl)-4-biphenylyl]methyl}-L-valine |
| (2S)-2-(N-((2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)-4-hydroxypentanamido)-3-methylbutanoic acid |
| N-(1-oxo-4-hydroxypentyl)-N-((2'-(1H-tetrazol-5-yl)(1,1'-biphenyl)-4-yl)methyl)-L-valine |
| L-Valine, N-(4-hydroxy-1-oxopentyl)-N-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]- |
| Valeryl-4-hydroxyvalsartan |
| UNII:N891C54AXX |
| (2S)-2-[4-hydroxypentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoic acid |
| UNII-N891C54AXX |
| Valsartan Impurity 4 |
