Introduction:Basic information about CAS 79925-38-5|Nemadipine-B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nemadipine-B |
|---|
| CAS Number | 79925-38-5 | Molecular Weight | 398.280 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 483.3±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H21Cl2NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 246.1±28.7 °C |
|---|
Names
| Name | diethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 483.3±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H21Cl2NO4 |
|---|
| Molecular Weight | 398.280 |
|---|
| Flash Point | 246.1±28.7 °C |
|---|
| Exact Mass | 397.084778 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 5.36 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | BLLWOXSSRQPDAT-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cccc(Cl)c1Cl |
|---|
Synonyms
| 3,5-Pyridinedicarboxylic acid, 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-, diethyl ester |
| Felodipine Impurity C |
| Diethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate |
| Nemadipine B |
| Felodipine Impurity 3 |