Introduction:Basic information about CAS 926189-86-8|N-[2-(diethylamino)-2-oxoethyl]-N-methylsulfamoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-(diethylamino)-2-oxoethyl]-N-methylsulfamoyl chloride |
|---|
| CAS Number | 926189-86-8 | Molecular Weight | 242.72400 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 353.486ºC at 760 mmHg |
|---|
| Molecular Formula | C7H15ClN2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.582ºC |
|---|
Names
| Name | N-[2-(diethylamino)-2-oxoethyl]-N-methylsulfamoyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 353.486ºC at 760 mmHg |
|---|
| Molecular Formula | C7H15ClN2O3S |
|---|
| Molecular Weight | 242.72400 |
|---|
| Flash Point | 167.582ºC |
|---|
| Exact Mass | 242.04900 |
|---|
| PSA | 66.07000 |
|---|
| LogP | 1.35100 |
|---|
| Index of Refraction | 1.507 |
|---|
| InChIKey | ILIJSUFNSQCLLZ-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)C(=O)CN(C)S(=O)(=O)Cl |
|---|