Introduction：Basic information about CAS 65329-79-5|Mobenzoxamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mobenzoxamine |
|---|
| CAS Number | 65329-79-5 | Molecular Weight | 490.60900 |
|---|
| Density | 1.136g/cm3 | Boiling Point | 616.6ºC at 760 mmHg |
|---|
| Molecular Formula | C30H35FN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 326.7ºC |
|---|
Names
| Name | 1-(4-fluorophenyl)-4-[4-[2-[(4-methoxyphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.136g/cm3 |
|---|
| Boiling Point | 616.6ºC at 760 mmHg |
|---|
| Molecular Formula | C30H35FN2O3 |
|---|
| Molecular Weight | 490.60900 |
|---|
| Flash Point | 326.7ºC |
|---|
| Exact Mass | 490.26300 |
|---|
| PSA | 42.01000 |
|---|
| LogP | 5.09680 |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | DFNYDADZMXPPLY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(OCCN2CCN(CCCC(=O)c3ccc(F)cc3)CC2)c2ccccc2)cc1 |
|---|
Synonyms
| Mobenzoxaminum [INN-Latin] |
| Mobenzoxamina |
| Mobenzoxamine |
| Mobenzoxaminum |
| mobenzoxamine[inn] |
| 1-(4-fluoro-phenyl)-4-{4-[2-(4-methoxy-benzhydryloxy)-ethyl]-piperazin-1-yl}-butan-1-one |
| Mobenzoxamina [INN-Spanish] |
