Introduction：Basic information about CAS 38527-91-2|PROTHIOFOS OXON, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | PROTHIOFOS OXON |
|---|
| CAS Number | 38527-91-2 | Molecular Weight | 329.18000 |
|---|
| Density | 1.328g/cm3 | Boiling Point | 389.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15Cl2O3PS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.2ºC |
|---|
Names
| Name | etaphos |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.328g/cm3 |
|---|
| Boiling Point | 389.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15Cl2O3PS |
|---|
| Molecular Weight | 329.18000 |
|---|
| Flash Point | 189.2ºC |
|---|
| Exact Mass | 327.98600 |
|---|
| PSA | 70.64000 |
|---|
| LogP | 5.66000 |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | ZGPVUVBRTCPAPZ-UHFFFAOYSA-N |
|---|
| SMILES | CCCSP(=O)(OCC)Oc1ccc(Cl)cc1Cl |
|---|
Safety Information
Customs
| HS Code | 2920190090 |
|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| O-(2,4-Dichlorophenyl) O-ethyl S-propyl phosphorothioate |
| (RS)-[O-2,4-dichlorophenyl O-ethyl S-propyl phosphorothioate] |
| prothiofos oxon |
| O-(2,4-dichlorophenyl) O-ethyl-S-propyl ester |
| 3,4,5-tris(benzyloxy)-6-(benzyloxymethyl)tetrahydro-2H-pyran-2-yl 2,2,2-trichloroacetimidate |
| 2,3,4,6-Tetra-O-benzyl-|A-D-glucopyranosyl trichloroacetimidate |
| profenophos |
| (Ξ)-[O-(2,4-dichlorophenyl) O-ethyl S-propyl phosphorothioate] |
| phosphorothioic acid |
| O-ethyl-S-propyl O-(2,4-dichloro-phenyl) thionophosphate |
| O-(2,4-dichlorophenyl) O-ethyl S-propyl phosphorothioate |
