Introduction：Basic information about CAS 58416-00-5|Protiofate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Protiofate |
|---|
| CAS Number | 58416-00-5 | Molecular Weight | 288.31700 |
|---|
| Density | 1.401g/cm3 | Boiling Point | 371.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H16O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.6ºC |
|---|
Names
| Name | dipropyl 3,4-dihydroxythiophene-2,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.401g/cm3 |
|---|
| Boiling Point | 371.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H16O6S |
|---|
| Molecular Weight | 288.31700 |
|---|
| Flash Point | 178.6ºC |
|---|
| Exact Mass | 288.06700 |
|---|
| PSA | 121.30000 |
|---|
| LogP | 2.29290 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | GUFHWUFYAOUKTI-UHFFFAOYSA-N |
|---|
| SMILES | CCCOC(=O)c1sc(C(=O)OCCC)c(O)c1O |
|---|
Synonyms
| Protiofate |
| BT-799 |
| Protiofato |
| Protiofatum |
| Protiofato [Spanish] |
| Protiofato [INN-Spanish] |
| Protiofatum [INN-Latin] |
| Protiofate (INN) |
| Atrimycon |
