Introduction：Basic information about CAS 77650-95-4|Proterguride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Proterguride |
|---|
| CAS Number | 77650-95-4 | Molecular Weight | 368.51600 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 602.9ºC at 760 mmHg |
|---|
| Molecular Formula | C22H32N4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 318.4ºC |
|---|
Names
| Name | 3-[(6aR,9S,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-yl]-1,1-diethylurea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 602.9ºC at 760 mmHg |
|---|
| Molecular Formula | C22H32N4O |
|---|
| Molecular Weight | 368.51600 |
|---|
| Flash Point | 318.4ºC |
|---|
| Exact Mass | 368.25800 |
|---|
| PSA | 54.86000 |
|---|
| LogP | 3.85420 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | FCRJELOYDVBTGW-ILZDJORESA-N |
|---|
| SMILES | CCCN1CC(NC(=O)N(CC)CC)CC2c3cccc4[nH]cc(c34)CC21 |
|---|
Synonyms
| Urea,N,N-diethyl-N'-((8alpha)-6-propylergolin-8-yl) |
| Protergurida [Spanish] |
| Proterguridum [Latin] |
| 1-((5R,8S,10R)-6-Propyl-8-ergolinyl)-3,3-diethylurea |
| proterguride |
| 1,1-diethyl-3-(6-propylergolin-8a-yl)urea |
