Introduction：Basic information about CAS 92-76-2|4'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide |
|---|
| CAS Number | 92-76-2 | Molecular Weight | 311.76200 |
|---|
| Density | 1.36 g/cm3 | Boiling Point | 426.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36 g/cm3 |
|---|
| Boiling Point | 426.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14ClNO2 |
|---|
| Molecular Weight | 311.76200 |
|---|
| Exact Mass | 311.07100 |
|---|
| PSA | 49.33000 |
|---|
| LogP | 4.83250 |
|---|
| Index of Refraction | 1.717 |
|---|
| InChIKey | PSRNXESQSJEQMN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1cc2ccccc2cc1O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Tulathol AS-TR. |
| naphtholas-trpurifiedcrystalline |
| Azoic C.C.8 |
| Naftol AS-TR |
| 3-hydroxy-naphthalene-2-carboxylic acid 4-chloro-2-methyl-anilide |
| NAPHTHOLAS-TR6 |
| EINECS 202-187-6 |
| C.I.Azoic Coupling Component 8 |
| naphthol ASTR |
| Amarthol AS-TR |
| Azoic coupling component 8 |
