Introduction：Basic information about CAS 720656-64-4|Benzeneacetic acid,2-[2-(dipropylamino)ethyl]-6-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzeneacetic acid,2-[2-(dipropylamino)ethyl]-6-nitro- |
|---|
| CAS Number | 720656-64-4 | Molecular Weight | 308.37300 |
|---|
| Density | 1.151g/cm3 | Boiling Point | 454.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H24N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.7ºC |
|---|
Names
| Name | 2-(2-n,n-dipropylaminoethyl)-6-nitrophenyl acetic acid |
|---|
Chemical & Physical Properties
| Density | 1.151g/cm3 |
|---|
| Boiling Point | 454.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H24N2O4 |
|---|
| Molecular Weight | 308.37300 |
|---|
| Flash Point | 228.7ºC |
|---|
| Exact Mass | 308.17400 |
|---|
| PSA | 86.36000 |
|---|
| LogP | 3.40960 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | PBMNGLVZPSNABM-UHFFFAOYSA-N |
|---|
| SMILES | CCCN(CCC)CCc1cccc([N+](=O)[O-])c1CC(=O)O |
|---|
