Introduction:Basic information about CAS 313963-93-8|5-sulfamoyl-1H-1,2,4-triazole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-sulfamoyl-1H-1,2,4-triazole-3-carboxylic acid |
|---|
| CAS Number | 313963-93-8 | Molecular Weight | 192.15300 |
|---|
| Density | 2.0±0.1 g/cm3 | Boiling Point | 667.7±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C3H4N4O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 357.6±26.8 °C |
|---|
Names
| Name | 5-sulfamoyl-1H-1,2,4-triazole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.0±0.1 g/cm3 |
|---|
| Boiling Point | 667.7±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C3H4N4O4S |
|---|
| Molecular Weight | 192.15300 |
|---|
| Flash Point | 357.6±26.8 °C |
|---|
| Exact Mass | 191.99500 |
|---|
| PSA | 147.41000 |
|---|
| LogP | -2.11 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | PUVBGNSTTRODNJ-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1nc(C(=O)O)n[nH]1 |
|---|
Synonyms
| 3-Sulfamoyl-1H-1,2,4-triazole-5-carboxylic acid |
| 1H-1,2,4-Triazole-3-carboxylic acid, 5-(aminosulfonyl)- |
| MFCD18807106 |
| 5-(aminosulfonyl)-1H-1,2,4-Triazole-3-carboxylic acid |