Introduction:Basic information about CAS 58089-25-1|2-mercapto-5-benzimidazolecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-mercapto-5-benzimidazolecarboxylic acid |
|---|
| CAS Number | 58089-25-1 | Molecular Weight | 194.21000 |
|---|
| Density | 1.01 g/mL at 25 °C | Boiling Point | >100 °C |
|---|
| Molecular Formula | C8H6N2O2S | Melting Point | 248 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 203.6ºC |
|---|
Names
| Name | 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.01 g/mL at 25 °C |
|---|
| Boiling Point | >100 °C |
|---|
| Melting Point | 248 °C (dec.)(lit.) |
|---|
| Molecular Formula | C8H6N2O2S |
|---|
| Molecular Weight | 194.21000 |
|---|
| Flash Point | 203.6ºC |
|---|
| Exact Mass | 194.01500 |
|---|
| PSA | 100.97000 |
|---|
| LogP | 1.92370 |
|---|
| Index of Refraction | 1.783 |
|---|
| InChIKey | DCRZVUIGGYMOBI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc2[nH]c(=S)[nH]c2c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R36/38:Irritating to eyes and skin . R36/37/38:Irritating to eyes, respiratory system and skin . R22:Harmful if swallowed. |
|---|
| Safety Phrases | S26-S36-S37/39 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | AH4410000 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Mercapto-5-benzimidazolecarboxylic acid |
| 2-mercaptobenzimidazole-5-carboxylic acid |
| 5-carboxy-2-mercaptobenzimidazole |
| 2-Mercapto-1H-benzimidazole-5-carboxylic acid |
| 2-Mercapto-1h-benzoimidazole-5-carboxylic acid |
| 2-sulfanylbenzimidazole-5-carboxylic acid |
| 2-mercapto-5-carboxybenzimidazole |
| MFCD01318607 |
| 2-mercaptobenzoimidazole-5-carboxylic acid |
| 2-thioxo-2,3-dihydro-1H-benzimidazole-5-carboxylic acid |
| F0400-0063 |
| 5-carboxy-2-benzimidazolethiol |