Introduction：Basic information about CAS 495-91-0|chavicine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | chavicine |
|---|
| CAS Number | 495-91-0 | Molecular Weight | 285.33800 |
|---|
| Density | 1.211g/cm3 | Boiling Point | 498.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 255.3ºC |
|---|
Names
| Name | (2Z,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.211g/cm3 |
|---|
| Boiling Point | 498.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19NO3 |
|---|
| Molecular Weight | 285.33800 |
|---|
| Flash Point | 255.3ºC |
|---|
| Exact Mass | 285.13600 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 2.93510 |
|---|
| Vapour Pressure | 4.5E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | MXXWOMGUGJBKIW-PORYWJCVSA-N |
|---|
| SMILES | O=C(C=CC=Cc1ccc2c(c1)OCO2)N1CCCCC1 |
|---|
Synonyms
| cis-cis-Piperin |
| 1-cis,cis-Piperinoyl-piperidin |
| 1-cis,cis-piperinoyl-piperidine |
| Chavicine |
