Introduction:Basic information about CAS 582-69-4|Benzoic acid,4,4'-(1-oxido-1,2-diazenediyl)bis-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,4,4'-(1-oxido-1,2-diazenediyl)bis- |
|---|
| CAS Number | 582-69-4 | Molecular Weight | 286.24000 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 562.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O5 | Melting Point | 360ºC (dec) |
|---|
| MSDS | / | Flash Point | 294ºC |
|---|
Names
| Name | (4-carboxyphenyl)-(4-carboxyphenyl)imino-oxidoazanium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 562.5ºC at 760 mmHg |
|---|
| Melting Point | 360ºC (dec) |
|---|
| Molecular Formula | C14H10N2O5 |
|---|
| Molecular Weight | 286.24000 |
|---|
| Flash Point | 294ºC |
|---|
| Exact Mass | 286.05900 |
|---|
| PSA | 115.71000 |
|---|
| LogP | 3.53190 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | ZYVHVGJGLOEEKD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(N=[N+]([O-])c2ccc(C(=O)O)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| azoxybenzene-4,4'-dicarboxylic acid |
| 4,4'-Azoxybenzendicarbonsaeure |
| 4,4'-dicarboxyazoxybenzene |
| 4,4'-dicarboxylic acid azoxybenzene |
| p,p'-dicarboxylazoxybenzene |
| 4,4'-dicarboxyazobenzene N-oxide |
| Benzoic acid,4'-azoxydi |
| 4,4'-Azoxybenzoic acid |
| Benzoic acid,4'-azoxybis |
| 4,4'-Azoxydibenzoic acid |