CAS 81-86-7|4-Bromo-1,8-naphthalic Anhydride
Introduction：Basic information about CAS 81-86-7|4-Bromo-1,8-naphthalic Anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-1,8-naphthalic Anhydride | ||
|---|---|---|---|
| CAS Number | 81-86-7 | Molecular Weight | 277.070 |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 467.2±28.0 °C at 760 mmHg |
| Molecular Formula | C12H5BrO3 | Melting Point | 217-219 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 236.3±24.0 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 4-Bromo-1,8-naphthalic Anhydride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.2±28.0 °C at 760 mmHg |
| Melting Point | 217-219 °C(lit.) |
| Molecular Formula | C12H5BrO3 |
| Molecular Weight | 277.070 |
| Flash Point | 236.3±24.0 °C |
| Exact Mass | 275.942200 |
| PSA | 43.37000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | DTUOTSLAFJCQHN-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2ccc(Br)c3cccc1c23 |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
Preparation
Customs
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Articles2
More Articles| White light emission from a two-component hybrid gel via an energy transfer process. Phys. Chem. Chem. Phys. 17 , 32297-303, (2015) A two-component light-harvesting organogel containing a naphthalimide-based gelator (1) as a donor and a phosphorescent Ir(III) complex [Ir(bt)2(acac)] (bt = 2-phenylbenzothiazole and acac = acetylace... | |
| A Programmed DNA Marker Based on Bis(4-ethynyl-1,8-naphthalimide) and Three-Methane-Bridged Thiazole Orange. Chemistry 21 , 16623-30, (2015) Two large conjugated naphthalimide derivatives with or without three-methane-bridged thiazole orange (TO3; i.e., compounds 1 a and 2 a, respectively) were designed and synthesized. The fluorescence of... |
Synonyms
| 2-bromo-1,8-naphthalic anhydride |
| 4-BR0MO-1.8-NAPHTHALIC ANHYDRIDE |
| 6-BROMO-BENZO[DE]ISOCHROMENE-1,3-DIONE |
| MFCD00006927 |
| 8-bromo-1,8-naphthalic anhydride |
| 4-BROMO-1,8-NAPHTHALENEDICARBOXYLIC ANHYDRIDE |
| bromo-1,8 naphthalic anhydride |
| 2-Bromnaphthalin-1,8-dicarbonsaeure |
| 6-bromo-1H,3H-naphtho[1,8-cd]pyran-1,3-dione |
| 6-Bromo-1H,3H-naphtho(1,8-cd)pyran-1,3-dione |
| 1H,3H-Naphtho(1,8-cd)pyran-1,3-dione, 6-bromo- |
| 1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-bromo- |
| 4-Bromobenzo[de]isochromene-1,3-dione |
| 2-bromonaphthalic anhydride |
| 4-Bromo-1,8-naphthalic anhydride |
| 2-Brom-naphthalin-1,8-dicarbonsaeure-anhydrid |
| 6-bromo-1,8-naphthalicanhydride |
| 4-Bromonaphthalene-1,8-dicarboxylic anhydride |
| 6-Bromo-1H,3H-benzo[de]isochromene-1,3-dione |
| EINECS 201-382-3 |
| 2-bromo-naphthalene-1,8-dicarboxylic acid-anhydride |
| 4-Bromo-1,8-naphthal |
