Introduction：Basic information about CAS 7706-67-4|Hepadial, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hepadial |
|---|
| CAS Number | 7706-67-4 | Molecular Weight | 222.237 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 381.2±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14O4 | Melting Point | 154.0-157ºC |
|---|
| MSDS | / | Flash Point | 146.3±17.2 °C |
|---|
Names
| Name | Dimecrotic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 381.2±27.0 °C at 760 mmHg |
|---|
| Melting Point | 154.0-157ºC |
|---|
| Molecular Formula | C12H14O4 |
|---|
| Molecular Weight | 222.237 |
|---|
| Flash Point | 146.3±17.2 °C |
|---|
| Exact Mass | 222.089203 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.80 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | VNLOISSPTMDCIF-SOFGYWHQSA-N |
|---|
| SMILES | COc1ccc(C(C)=CC(=O)O)c(OC)c1 |
|---|
Synonyms
| 2,4-Dimethoxy-b-methylcinnamic Acid |
| Hepadial |
| 3-<2,4-Dimethoxy-phenyl>-3-methyl-acrylsaeure |
| 2-Butenoic acid, 3-(2,4-dimethoxyphenyl)-, (2E)- |
| Dimecrotic |
| (2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid |
| (2E)-3-(2,4-dimethoxyphenyl)but-2-enoic acid |
