Introduction：Basic information about CAS 6544-68-9|18-Methyl-estrone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 18-Methyl-estrone |
|---|
| CAS Number | 6544-68-9 | Molecular Weight | 284.39300 |
|---|
| Density | 1.138 g/cm3 | Boiling Point | 456.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(5,7-dichloro-2-oxo-1H-indol-3-ylidene)-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.138 g/cm3 |
|---|
| Boiling Point | 456.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24O2 |
|---|
| Molecular Weight | 284.39300 |
|---|
| Exact Mass | 284.17800 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.20750 |
|---|
| Index of Refraction | 1.77 |
|---|
| InChIKey | QKZWZIYNUGTOGS-UHFFFAOYSA-N |
|---|
| SMILES | CCn1c(O)c(C2=c3cc(Cl)cc(Cl)c3=NC2=O)sc1=S |
|---|
Synonyms
| 3-hydroxy-18a-homoestra-1,3,5(10)-trien-17-one |
| 18-Methyl-estrone |
| 3-hydroxy-18-methyl-estra-1,3,5(10)-trien-17-one |
| 18a-methylestrone |
