Introduction：Basic information about CAS 825-94-5|p-chlorophenyltrichlorosilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-chlorophenyltrichlorosilane |
|---|
| CAS Number | 825-94-5 | Molecular Weight | 245.993 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 222.9±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4Cl4Si | Melting Point | < 0ºC |
|---|
| MSDS | / | Flash Point | 98.7±14.6 °C |
|---|
Names
| Name | trichloro-(4-chlorophenyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 222.9±13.0 °C at 760 mmHg |
|---|
| Melting Point | < 0ºC |
|---|
| Molecular Formula | C6H4Cl4Si |
|---|
| Molecular Weight | 245.993 |
|---|
| Flash Point | 98.7±14.6 °C |
|---|
| Exact Mass | 243.883636 |
|---|
| LogP | 6.54 |
|---|
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | ABADVTXFGWCNBV-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc([Si](Cl)(Cl)Cl)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 2987 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
Synonyms
| p-chlorophenyltrichlorosilane |
| 4-Chlorophenyltrichlorosilane |
| Trichlor-p-chlorphenylsilan |
| [4-Chlor-phenyl-trichlor-monosilan |
| Trichlor-(4-chlor-phenyl)-silan |
| trichloro-(4-chloro-phenyl)-silane |
| (ph-4-Cl)SiCl3 |
| Trichloro(p-chlorophenyl)silane |
| Trichloro(4-chlorophenyl)silane |
| Silane,trichloro(4-chlorophenyl) |
| (4-Chlor-phenyl)-siliciumtrichlorid |
| Benzene, 1-chloro-4-(trichlorosilyl)- |
| MFCD00053181 |
| Silane, trichloro(4-chlorophenyl)- |
| EINECS 212-551-6 |
