Introduction：Basic information about CAS 3390-61-2|1,3,5-Trimethyl-1,1,3,5,5-pentaphenyltrisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-Trimethyl-1,1,3,5,5-pentaphenyltrisiloxane |
|---|
| CAS Number | 3390-61-2 | Molecular Weight | 546.878 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 560.2±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C33H34O2Si3 | Melting Point | -25°C |
|---|
| MSDS | / | Flash Point | 238.3±25.8 °C |
|---|
Names
| Name | methyl-bis[[methyl(diphenyl)silyl]oxy]-phenylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 560.2±33.0 °C at 760 mmHg |
|---|
| Melting Point | -25°C |
|---|
| Molecular Formula | C33H34O2Si3 |
|---|
| Molecular Weight | 546.878 |
|---|
| Flash Point | 238.3±25.8 °C |
|---|
| Exact Mass | 546.186646 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 13.50 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | PHLASVAENYNAOW-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](O[Si](C)(c1ccccc1)c1ccccc1)(O[Si](C)(c1ccccc1)c1ccccc1)c1ccccc1 |
|---|
| Storage condition | 2~8℃，Seal |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | 26-36-39 |
|---|
| RIDADR | UN 2810 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Dow Corning 555 |
| UNII-HE7ABK56N5 |
| 1,1,3,5,5-pentaphenyl-1,3,5-trimethyltrisiloxane |
| EINECS 222-222-9 |
| Si1.Si2.Si3-Trimethyl-Si1.Si1.Si2.Si3.Si3-pentaphenyl-trisiloxan |
| Trisiloxane,1,3,5-trimethyl-1,1,3,5,5-pentaphenyl |
| MFCD00053659 |
| Trisiloxane, 1,3,5-trimethyl-1,1,3,5,5-pentaphenyl- |
| 1,3,5-Trimethyl-1,1,3,5,5-pentaphenyltrisiloxane |
| Benzene, 1,1',1'',1''',1''''-(1,3,5-trimethyl-3-trisiloxanyl-1,5-diylidene)pentakis- |
| 1,3,5-Trimethyl-1,1,3,5,5-tetraphenyl-trisiloxan |
| trimethyl pentaphenyl trisiloxane |
| Dow Corning 705 |
| 1.3.5-Trimethyl-1.1.3.5.5-pentaphenyl-trisiloxan |
