Introduction:Basic information about CAS 33844-21-2|4-Methoxy-2-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methoxy-2-nitrobenzoic acid |
|---|
| CAS Number | 33844-21-2 | Molecular Weight | 197.145 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 372.9±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7NO5 | Melting Point | 196.5-200.5 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 179.3±23.7 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Methoxy-2-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 372.9±27.0 °C at 760 mmHg |
|---|
| Melting Point | 196.5-200.5 °C(lit.) |
|---|
| Molecular Formula | C8H7NO5 |
|---|
| Molecular Weight | 197.145 |
|---|
| Flash Point | 179.3±23.7 °C |
|---|
| Exact Mass | 197.032425 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 1.93 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | DVZBWONCSHFMMM-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)O)c([N+](=O)[O-])c1 |
|---|
| Storage condition | Keep Cold |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H332 |
|---|
| Precautionary Statements | P280 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 2 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Nitro-p-anisic acid |
| WNR BVQ EO1 |
| 2-Nitroanisic acid |
| MFCD04972109 |
| Benzoic acid, 4-methoxy-2-nitro- |
| Benzoic acid,4-methoxy-2-nitro |
| 2-Nitro-4-methoxybenzoic acid |
| 4-methoxy-2-nitro-benzoic acid |
| 4-Methoxy-2-nitrobenzoic acid |
| 4-methoxy-6-nitrobenzoic acid |
| 2-Nitro-anissaeure |
| 4-Methoxy-2-nitro-benzoesaeure |