Introduction：Basic information about CAS 103541-15-7|Clausenamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Clausenamide |
|---|
| CAS Number | 103541-15-7 | Molecular Weight | 297.34800 |
|---|
| Density | 1.27 g/cm3 | Boiling Point | 531.7ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 275.3ºC |
|---|
Names
| Name | Clausenamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.27 g/cm3 |
|---|
| Boiling Point | 531.7ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19NO3 |
|---|
| Molecular Weight | 297.34800 |
|---|
| Flash Point | 275.3ºC |
|---|
| Exact Mass | 297.13600 |
|---|
| PSA | 60.77000 |
|---|
| LogP | 1.64320 |
|---|
| Vapour Pressure | 3.91E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | WGYGSZOQGYRGIP-MWDXBVQZSA-N |
|---|
| SMILES | CN1C(=O)C(O)C(c2ccccc2)C1C(O)c1ccccc1 |
|---|
Synonyms
| levoclausenamide |
| rac-clausenamide |
| (-)-3-hydroxy-5-(hydroxy-phenyl-methyl)-1-methyl-4-phenyl-pyrrolidin-2-one |
| (+/-)-clausenamide |
| (3R,4S,5S)-3-Hydroxy-5-[(R)-hydroxy-phenylmethyl]-1-methyl-4-phenylpyrrolidin-2-one |
