Introduction：Basic information about CAS 6657-32-5|3-[(2-hydroxyethyl)[4-[(4-nitrophenyl)azo]phenyl]amino]propiononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(2-hydroxyethyl)[4-[(4-nitrophenyl)azo]phenyl]amino]propiononitrile |
|---|
| CAS Number | 6657-32-5 | Molecular Weight | 339.34900 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 609.6ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17N5O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 322.5ºC |
|---|
Names
| Name | 3-[(2-hydroxyethyl)[4-[(4-nitrophenyl)azo]phenyl]amino]propiononitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 609.6ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17N5O3 |
|---|
| Molecular Weight | 339.34900 |
|---|
| Flash Point | 322.5ºC |
|---|
| Exact Mass | 339.13300 |
|---|
| PSA | 117.80000 |
|---|
| LogP | 4.24578 |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | OGHAROMWUKGSDP-UHFFFAOYSA-N |
|---|
| SMILES | N#CCCN(CCO)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2)cc1 |
|---|
Synonyms
| Disperse Orange A press cake |
| Propanenitrile,3-((2-hydroxyethyl)(4-((4-nitrophenyl)azo)phenyl)amino) |
| 4-Nitro-4'-(N-cyanoethyl-N-hydroxyethyl-amino)-azobenzol |
| 4'-Nitro-4-<N-cyanoaethyl-N-hydroxyaethyl-amino>-azobenzol |
| 3-[(2-hydroxyethyl)[4-[(4-nitrophenyl)azo]phenyl]amino]-propanenitril |
| 3-((2-hydroxyethyl){4-[(4-nitrophenyl)azo]phenyl}amino)propiononitrile |
| N-(2-Cyanoethyl)-N-(2-hydroxyethyl)-4-(p-nitrophenylazo)aniline |
| 3-[N-(2-Hydroxyethyl)-4-(4-nitrophenylazo)phenylamino]propanenitrile |
| 3-[(4'-Nitroazobenzene-4-yl)(2-hydroxyethyl)amino]propiononitrile |
| 3-[(2-hydroxyethyl)[4-[(4-nitrophenyl)azo]phenyl] amino]-Propanenitrile |
| Disperse Orange A |
| Einecs 229-690-3 |
