Introduction：Basic information about CAS 69472-19-1|3-[butyl[4-[(4-nitrophenyl)azo]phenyl]amino]propiononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[butyl[4-[(4-nitrophenyl)azo]phenyl]amino]propiononitrile |
|---|
| CAS Number | 69472-19-1 | Molecular Weight | 351.40200 |
|---|
| Density | 1.16 g/cm3 | Boiling Point | 569.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21N5O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-[N-butyl-4-[(4-nitrophenyl)diazenyl]anilino]propanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16 g/cm3 |
|---|
| Boiling Point | 569.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21N5O2 |
|---|
| Molecular Weight | 351.40200 |
|---|
| Exact Mass | 351.17000 |
|---|
| PSA | 97.57000 |
|---|
| LogP | 6.05358 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | MVKMKUHSGHKEDT-UHFFFAOYSA-N |
|---|
| SMILES | CCCCN(CCC#N)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2)cc1 |
|---|
Synonyms
| Disperse Orange 33 |
| Propanenitrile,3-(butyl(4-((4-nitrophenyl)azo)phenyl)amino) |
| Propanenitrile,3-(butyl(4-(2-(4-nitrophenyl)diazenyl)phenyl)amino) |
| EINECS 274-016-3 |
| 3-(Butyl(4-((4-nitrophenyl)azo)phenyl)amino)propiononitrile |
