Introduction：Basic information about CAS 2537-62-4|N-[2-[(2-bromo-6-cyano-4-nitrophenyl)azo]-5-(diethylamino)phenyl]acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[(2-bromo-6-cyano-4-nitrophenyl)azo]-5-(diethylamino)phenyl]acetamide |
|---|
| CAS Number | 2537-62-4 | Molecular Weight | 459.29700 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 685.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H19BrN6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-[2-[(2-bromo-6-cyano-4-nitrophenyl)azo]-5-(diethylamino)phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 685.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H19BrN6O3 |
|---|
| Molecular Weight | 459.29700 |
|---|
| Exact Mass | 458.07000 |
|---|
| PSA | 126.67000 |
|---|
| LogP | 6.04518 |
|---|
| Vapour Pressure | 1.26E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | KTXMBTRTVMMWQS-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc(N=Nc2c(Br)cc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1 |
|---|
Synonyms
| C.I. Disperse Blue 183:1 press cake |
| N-{2-[(2-bromo-6-cyano-4-nitrophenyl)azo]-5-(diethylamino)phenyl}acetamide |
| n-[2-[(2-bromo-6-cyano-4-nitrophenyl)azo]-5-(diethylamino)phenyl]-acetamid |
| Acetamide,N-[2-[(2-bromo-6-cyano-4-nitrophenyl)azo]-5-(diethylamino)phenyl]-(9Cl) |
| Disperse Blue 183:1 |
| Acetamide,N-2-(2-bromo-6-cyano-4-nitrophenyl)azo-5-(diethylamino)phenyl |
| 2'-(Acetylamino)-6-bromo-4'-(diethylamino)-4-nitroazobenzene-2-carbonitrile |
