Introduction:Basic information about CAS 58775-05-6|2,7-Di-tert-butylfluorene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,7-Di-tert-butylfluorene |
|---|
| CAS Number | 58775-05-6 | Molecular Weight | 278.431 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 372.4±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H26 | Melting Point | 121-124 °C(lit.) |
|---|
| MSDS | / | Flash Point | 194.1±13.1 °C |
|---|
Names
| Name | 2,7-Di-tert-butylfluorene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 372.4±22.0 °C at 760 mmHg |
|---|
| Melting Point | 121-124 °C(lit.) |
|---|
| Molecular Formula | C21H26 |
|---|
| Molecular Weight | 278.431 |
|---|
| Flash Point | 194.1±13.1 °C |
|---|
| Exact Mass | 278.203461 |
|---|
| LogP | 7.54 |
|---|
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | DFZYPLLGAQIQTD-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc2c(c1)Cc1cc(C(C)(C)C)ccc1-2 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| 2,7-Bis(2-methyl-2-propanyl)-9H-fluorene |
| 2,7-ditert-butyl-9H-fluorene |
| 2,7-di-tert-butyl-9H-fluorene |
| MFCD03093998 |
| 9H-Fluorene, 2,7-bis(1,1-dimethylethyl)- |