Introduction:Basic information about CAS 92050-16-3|5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-ylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-ylamine |
|---|
| CAS Number | 92050-16-3 | Molecular Weight | 203.323 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 310.2±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H21N | Melting Point | 63-65ºC |
|---|
| MSDS | / | Flash Point | 143.5±20.1 °C |
|---|
Names
| Name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 310.2±31.0 °C at 760 mmHg |
|---|
| Melting Point | 63-65ºC |
|---|
| Molecular Formula | C14H21N |
|---|
| Molecular Weight | 203.323 |
|---|
| Flash Point | 143.5±20.1 °C |
|---|
| Exact Mass | 203.167404 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.69 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | AMDKYPNODLTUMY-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CCC(C)(C)c2cc(N)ccc21 |
|---|
Safety Information
Customs
| HS Code | 2921450090 |
|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| 5,6,7,8-tetrahydro-5,5,8,8-tetramethylnaphtalen-2-amine |
| 1,1,4,4-tetramethyl-1,2,3,4-tetrahydro-naphth-6-ylamine |
| 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-ylamine |
| 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenamine |
| 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine |
| 1,1,4,4-tetramethyl-1,2,3,4-tetrahydro-6-aminonaphthalene |
| 2-Naphthalenamine, 5,6,7,8-tetrahydro-5,5,8,8-tetramethyl- |
| 2-amino-5,6,7,8-tetrahydro-5,5,8,8-tetramethylnaphthalene |
| 2-amino-5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalene |