Introduction：Basic information about CAS 4514-54-9|6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|
| CAS Number | 4514-54-9 | Molecular Weight | 221.64600 |
|---|
| Density | 1.468g/cm3 | Boiling Point | 530.1ºC at 760mmHg |
|---|
| Molecular Formula | C9H8ClN5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 274.4ºC |
|---|
Names
| Name | 6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.468g/cm3 |
|---|
| Boiling Point | 530.1ºC at 760mmHg |
|---|
| Molecular Formula | C9H8ClN5 |
|---|
| Molecular Weight | 221.64600 |
|---|
| Flash Point | 274.4ºC |
|---|
| Exact Mass | 221.04700 |
|---|
| PSA | 90.71000 |
|---|
| LogP | 2.51880 |
|---|
| Index of Refraction | 1.702 |
|---|
| InChIKey | QBLXLPLVBAYDMX-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(N)nc(-c2cccc(Cl)c2)n1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2,4-Diamino-6-(m-chlorphenyl)-s-triazin |
| [159] 2,4-Diamino-6-(3-chlorophenyl)-1,3,5-triazine |
| 2.4-Diamino-6-(3-chlor-phenyl)-1.3.5-triazin |
| 6-(3-chloro-phenyl)-[1,3,5]triazine-2,4-diamine |
| HMS2212N22 |
| m-Chlorophenylguanamin |
