Introduction：Basic information about CAS 92513-52-5|6-methoxyquinoline-2,3-dicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-methoxyquinoline-2,3-dicarboxylic acid |
|---|
| CAS Number | 92513-52-5 | Molecular Weight | 247.20400 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 455.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.3ºC |
|---|
Names
| Name | 6-methoxyquinoline-2,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 455.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9NO5 |
|---|
| Molecular Weight | 247.20400 |
|---|
| Flash Point | 229.3ºC |
|---|
| Exact Mass | 247.04800 |
|---|
| PSA | 96.72000 |
|---|
| LogP | 1.63980 |
|---|
| Index of Refraction | 1.68 |
|---|
| InChIKey | XHNRULRQAVVDBH-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2nc(C(=O)O)c(C(=O)O)cc2c1 |
|---|
Synonyms
| 2,3-Quinolinedicarboxylic acid,6-methoxy |
| QU125 |
